C13H19ClN2S — CID 19652193
1-[(4-chlorophenyl)methyl]-3-(3-methylbutyl)thiourea (PubChem CID 19652193) has the molecular formula C13H19ClN2S and a molecular weight of 270.83 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(3-methylbutyl)thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(3-methylbutyl)thiourea |
|---|---|
| PubChem CID | 19652193 |
| Molecular Formula | C13H19ClN2S |
| Molecular Weight | 270.83 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(3-methylbutyl)thiourea |
| SMILES | CC(C)CCNC(=S)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H19ClN2S/c1-10(2)7-8-15-13(17)16-9-11-3-5-12(14)6-4-11/h3-6,10H,7-9H2,1-2H3,(H2,15,16,17) |
| InChIKey | LNWRSJKTRJZHIK-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.83 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|