C17H21ClN4O — CID 109257600
N-[(4-chlorophenyl)methyl]-2-(3-methylbutylamino)pyrimidine-5-carboxamide (PubChem CID 109257600) has the molecular formula C17H21ClN4O and a molecular weight of 332.83 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-2-(3-methylbutylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-2-(3-methylbutylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109257600 |
| Molecular Formula | C17H21ClN4O |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-2-(3-methylbutylamino)pyrimidine-5-carboxamide |
| SMILES | CC(C)CCNc1ncc(C(=O)NCc2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C17H21ClN4O/c1-12(2)7-8-19-17-21-10-14(11-22-17)16(23)20-9-13-3-5-15(18)6-4-13/h3-6,10-12H,7-9H2,1-2H3,(H,20,23)(H,19,21,22) |
| InChIKey | ZUQILVPISOBKLL-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |