C16H17F3N4O — CID 109263625
2-(3-methylbutylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-5-carboxamide (PubChem CID 109263625) has the molecular formula C16H17F3N4O and a molecular weight of 338.33 g/mol. Its IUPAC name is 2-(3-methylbutylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-(3-methylbutylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109263625 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-(3-methylbutylamino)-N-(2,3,4-trifluorophenyl)pyrimidine-5-carboxamide |
| SMILES | CC(C)CCNc1ncc(C(=O)Nc2ccc(F)c(F)c2F)cn1 |
| InChI | InChI=1S/C16H17F3N4O/c1-9(2)5-6-20-16-21-7-10(8-22-16)15(24)23-12-4-3-11(17)13(18)14(12)19/h3-4,7-9H,5-6H2,1-2H3,(H,23,24)(H,20,21,22) |
| InChIKey | ZQJFSMKMRYKCIN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|