C18H19ClF3N3O — CID 109161212
N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(3-methylbutylamino)pyridine-3-carboxamide (PubChem CID 109161212) has the molecular formula C18H19ClF3N3O and a molecular weight of 385.82 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(3-methylbutylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(3-methylbutylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109161212 |
| Molecular Formula | C18H19ClF3N3O |
| Molecular Weight | 385.82 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(3-methylbutylamino)pyridine-3-carboxamide |
| SMILES | CC(C)CCNc1ccc(C(=O)Nc2ccc(Cl)cc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C18H19ClF3N3O/c1-11(2)7-8-23-16-6-3-12(10-24-16)17(26)25-15-5-4-13(19)9-14(15)18(20,21)22/h3-6,9-11H,7-8H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | WHFGRLFOBRPDGS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.82 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |