C18H22BrN3O — CID 109161206
N-(4-bromo-2-methylphenyl)-6-(3-methylbutylamino)pyridine-3-carboxamide (PubChem CID 109161206) has the molecular formula C18H22BrN3O and a molecular weight of 376.30 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-6-(3-methylbutylamino)pyridine-3-carboxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-6-(3-methylbutylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109161206 |
| Molecular Formula | C18H22BrN3O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-6-(3-methylbutylamino)pyridine-3-carboxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)c1ccc(NCCC(C)C)nc1 |
| InChI | InChI=1S/C18H22BrN3O/c1-12(2)8-9-20-17-7-4-14(11-21-17)18(23)22-16-6-5-15(19)10-13(16)3/h4-7,10-12H,8-9H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | OXROOPYKBKUZHS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |