C16H13ClF3N3O — CID 109151376
N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(cyclopropylamino)pyridine-3-carboxamide (PubChem CID 109151376) has the molecular formula C16H13ClF3N3O and a molecular weight of 355.75 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(cyclopropylamino)pyridine-3-carboxamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(cyclopropylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109151376 |
| Molecular Formula | C16H13ClF3N3O |
| Molecular Weight | 355.75 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(cyclopropylamino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)c1ccc(NC2CC2)nc1 |
| InChI | InChI=1S/C16H13ClF3N3O/c17-10-2-5-13(12(7-10)16(18,19)20)23-15(24)9-1-6-14(21-8-9)22-11-3-4-11/h1-2,5-8,11H,3-4H2,(H,21,22)(H,23,24) |
| InChIKey | CXAQDNUGMGFMDM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.75 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |