C18H18ClF3N4O — CID 109250623
N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(cyclohexylamino)pyrimidine-5-carboxamide (PubChem CID 109250623) has the molecular formula C18H18ClF3N4O and a molecular weight of 398.82 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(cyclohexylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(cyclohexylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109250623 |
| Molecular Formula | C18H18ClF3N4O |
| Molecular Weight | 398.82 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-2-(cyclohexylamino)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)c1cnc(NC2CCCCC2)nc1 |
| InChI | InChI=1S/C18H18ClF3N4O/c19-12-6-7-15(14(8-12)18(20,21)22)26-16(27)11-9-23-17(24-10-11)25-13-4-2-1-3-5-13/h6-10,13H,1-5H2,(H,26,27)(H,23,24,25) |
| InChIKey | DTQGANVMYHKLCY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.82 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |