C19H19ClF3N3O — CID 109152592
N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(4-methylpiperidin-1-yl)pyridine-3-carboxamide (PubChem CID 109152592) has the molecular formula C19H19ClF3N3O and a molecular weight of 397.83 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(4-methylpiperidin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(4-methylpiperidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109152592 |
| Molecular Formula | C19H19ClF3N3O |
| Molecular Weight | 397.83 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-6-(4-methylpiperidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC1CCN(c2ccc(C(=O)Nc3ccc(Cl)cc3C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C19H19ClF3N3O/c1-12-6-8-26(9-7-12)17-5-2-13(11-24-17)18(27)25-16-4-3-14(20)10-15(16)19(21,22)23/h2-5,10-12H,6-9H2,1H3,(H,25,27) |
| InChIKey | NZFNAMMTVSEZAU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.83 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |