C18H19Cl2N3O — CID 109152595
N-(2,5-dichlorophenyl)-6-(4-methylpiperidin-1-yl)pyridine-3-carboxamide (PubChem CID 109152595) has the molecular formula C18H19Cl2N3O and a molecular weight of 364.28 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-6-(4-methylpiperidin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-6-(4-methylpiperidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109152595 |
| Molecular Formula | C18H19Cl2N3O |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | N-(2,5-dichlorophenyl)-6-(4-methylpiperidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC1CCN(c2ccc(C(=O)Nc3cc(Cl)ccc3Cl)cn2)CC1 |
| InChI | InChI=1S/C18H19Cl2N3O/c1-12-6-8-23(9-7-12)17-5-2-13(11-21-17)18(24)22-16-10-14(19)3-4-15(16)20/h2-5,10-12H,6-9H2,1H3,(H,22,24) |
| InChIKey | DFPGTWBRLQEEMW-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |