C19H21ClN4O3 — CID 109342274
methyl 4-chloro-3-[[6-(4-methylpiperidin-1-yl)pyrimidine-4-carbonyl]amino]benzoate (PubChem CID 109342274) has the molecular formula C19H21ClN4O3 and a molecular weight of 388.86 g/mol. Its IUPAC name is methyl 4-chloro-3-[[6-(4-methylpiperidin-1-yl)pyrimidine-4-carbonyl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[6-(4-methylpiperidin-1-yl)pyrimidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109342274 |
| Molecular Formula | C19H21ClN4O3 |
| Molecular Weight | 388.86 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | methyl 4-chloro-3-[[6-(4-methylpiperidin-1-yl)pyrimidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(NC(=O)c2cc(N3CCC(C)CC3)ncn2)c1 |
| InChI | InChI=1S/C19H21ClN4O3/c1-12-5-7-24(8-6-12)17-10-16(21-11-22-17)18(25)23-15-9-13(19(26)27-2)3-4-14(15)20/h3-4,9-12H,5-8H2,1-2H3,(H,23,25) |
| InChIKey | CVLPJUCISQFHNL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.86 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |