C17H16ClF3N4O — CID 109274240
N-[4-chloro-2-(trifluoromethyl)phenyl]-5-(cyclopentylamino)pyrazine-2-carboxamide (PubChem CID 109274240) has the molecular formula C17H16ClF3N4O and a molecular weight of 384.79 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-5-(cyclopentylamino)pyrazine-2-carboxamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-5-(cyclopentylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109274240 |
| Molecular Formula | C17H16ClF3N4O |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-5-(cyclopentylamino)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)c1cnc(NC2CCCC2)cn1 |
| InChI | InChI=1S/C17H16ClF3N4O/c18-10-5-6-13(12(7-10)17(19,20)21)25-16(26)14-8-23-15(9-22-14)24-11-3-1-2-4-11/h5-9,11H,1-4H2,(H,23,24)(H,25,26) |
| InChIKey | JRBXUDLFBIMPMW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |