C16H14ClF3N4O — CID 109273671
[5-[4-chloro-2-(trifluoromethyl)anilino]pyrazin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 109273671) has the molecular formula C16H14ClF3N4O and a molecular weight of 370.76 g/mol. Its IUPAC name is [5-[4-chloro-2-(trifluoromethyl)anilino]pyrazin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-[4-chloro-2-(trifluoromethyl)anilino]pyrazin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 109273671 |
| Molecular Formula | C16H14ClF3N4O |
| Molecular Weight | 370.76 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | [5-[4-chloro-2-(trifluoromethyl)anilino]pyrazin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cnc(Nc2ccc(Cl)cc2C(F)(F)F)cn1)N1CCCC1 |
| InChI | InChI=1S/C16H14ClF3N4O/c17-10-3-4-12(11(7-10)16(18,19)20)23-14-9-21-13(8-22-14)15(25)24-5-1-2-6-24/h3-4,7-9H,1-2,5-6H2,(H,22,23) |
| InChIKey | XEDTZIYICXZCAS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |