C15H14ClF3N4O — CID 109270933
5-[4-chloro-2-(trifluoromethyl)anilino]-N-propylpyrazine-2-carboxamide (PubChem CID 109270933) has the molecular formula C15H14ClF3N4O and a molecular weight of 358.75 g/mol. Its IUPAC name is 5-[4-chloro-2-(trifluoromethyl)anilino]-N-propylpyrazine-2-carboxamide.
| Compound Name | 5-[4-chloro-2-(trifluoromethyl)anilino]-N-propylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109270933 |
| Molecular Formula | C15H14ClF3N4O |
| Molecular Weight | 358.75 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 5-[4-chloro-2-(trifluoromethyl)anilino]-N-propylpyrazine-2-carboxamide |
| SMILES | CCCNC(=O)c1cnc(Nc2ccc(Cl)cc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H14ClF3N4O/c1-2-5-20-14(24)12-7-22-13(8-21-12)23-11-4-3-9(16)6-10(11)15(17,18)19/h3-4,6-8H,2,5H2,1H3,(H,20,24)(H,22,23) |
| InChIKey | AAVKFLXJHGPORP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |