C17H17ClF3N3O — CID 109202636
N-butyl-4-[4-chloro-2-(trifluoromethyl)anilino]pyridine-2-carboxamide (PubChem CID 109202636) has the molecular formula C17H17ClF3N3O and a molecular weight of 371.79 g/mol. Its IUPAC name is N-butyl-4-[4-chloro-2-(trifluoromethyl)anilino]pyridine-2-carboxamide.
| Compound Name | N-butyl-4-[4-chloro-2-(trifluoromethyl)anilino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109202636 |
| Molecular Formula | C17H17ClF3N3O |
| Molecular Weight | 371.79 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | N-butyl-4-[4-chloro-2-(trifluoromethyl)anilino]pyridine-2-carboxamide |
| SMILES | CCCCNC(=O)c1cc(Nc2ccc(Cl)cc2C(F)(F)F)ccn1 |
| InChI | InChI=1S/C17H17ClF3N3O/c1-2-3-7-23-16(25)15-10-12(6-8-22-15)24-14-5-4-11(18)9-13(14)17(19,20)21/h4-6,8-10H,2-3,7H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | QHRXSJWZIRQRAA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.79 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|