C17H17ClF3N3O2 — CID 109184357
5-[4-chloro-2-(trifluoromethyl)anilino]-N-(3-methoxypropyl)pyridine-2-carboxamide (PubChem CID 109184357) has the molecular formula C17H17ClF3N3O2 and a molecular weight of 387.79 g/mol. Its IUPAC name is 5-[4-chloro-2-(trifluoromethyl)anilino]-N-(3-methoxypropyl)pyridine-2-carboxamide.
| Compound Name | 5-[4-chloro-2-(trifluoromethyl)anilino]-N-(3-methoxypropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109184357 |
| Molecular Formula | C17H17ClF3N3O2 |
| Molecular Weight | 387.79 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 5-[4-chloro-2-(trifluoromethyl)anilino]-N-(3-methoxypropyl)pyridine-2-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(Nc2ccc(Cl)cc2C(F)(F)F)cn1 |
| InChI | InChI=1S/C17H17ClF3N3O2/c1-26-8-2-7-22-16(25)15-6-4-12(10-23-15)24-14-5-3-11(18)9-13(14)17(19,20)21/h3-6,9-10,24H,2,7-8H2,1H3,(H,22,25) |
| InChIKey | LQKGAHLFWCWCCP-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.79 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|