C18H22ClN3O4 — CID 109184365
5-(4-chloro-2,5-dimethoxyanilino)-N-(3-methoxypropyl)pyridine-2-carboxamide (PubChem CID 109184365) has the molecular formula C18H22ClN3O4 and a molecular weight of 379.84 g/mol. Its IUPAC name is 5-(4-chloro-2,5-dimethoxyanilino)-N-(3-methoxypropyl)pyridine-2-carboxamide.
| Compound Name | 5-(4-chloro-2,5-dimethoxyanilino)-N-(3-methoxypropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109184365 |
| Molecular Formula | C18H22ClN3O4 |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 5-(4-chloro-2,5-dimethoxyanilino)-N-(3-methoxypropyl)pyridine-2-carboxamide |
| SMILES | COCCCNC(=O)c1ccc(Nc2cc(OC)c(Cl)cc2OC)cn1 |
| InChI | InChI=1S/C18H22ClN3O4/c1-24-8-4-7-20-18(23)14-6-5-12(11-21-14)22-15-10-16(25-2)13(19)9-17(15)26-3/h5-6,9-11,22H,4,7-8H2,1-3H3,(H,20,23) |
| InChIKey | YWXAQHHGWXMULD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|