C15H14Cl2N4O — CID 109273678
[5-(2,3-dichloroanilino)pyrazin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 109273678) has the molecular formula C15H14Cl2N4O and a molecular weight of 337.21 g/mol. Its IUPAC name is [5-(2,3-dichloroanilino)pyrazin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-(2,3-dichloroanilino)pyrazin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 109273678 |
| Molecular Formula | C15H14Cl2N4O |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | [5-(2,3-dichloroanilino)pyrazin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cnc(Nc2cccc(Cl)c2Cl)cn1)N1CCCC1 |
| InChI | InChI=1S/C15H14Cl2N4O/c16-10-4-3-5-11(14(10)17)20-13-9-18-12(8-19-13)15(22)21-6-1-2-7-21/h3-5,8-9H,1-2,6-7H2,(H,19,20) |
| InChIKey | OARSPJLCVSHQHF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |