C19H18ClN7O — CID 109286673
[5-(2-chloroanilino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 109286673) has the molecular formula C19H18ClN7O and a molecular weight of 395.85 g/mol. Its IUPAC name is [5-(2-chloroanilino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [5-(2-chloroanilino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109286673 |
| Molecular Formula | C19H18ClN7O |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | [5-(2-chloroanilino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cnc(Nc2ccccc2Cl)cn1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H18ClN7O/c20-14-4-1-2-5-15(14)25-17-13-23-16(12-24-17)18(28)26-8-10-27(11-9-26)19-21-6-3-7-22-19/h1-7,12-13H,8-11H2,(H,24,25) |
| InChIKey | PBBFRDOFGUPHKU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |