C18H25N7O — CID 109286649
[5-(3-methylbutylamino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 109286649) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is [5-(3-methylbutylamino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [5-(3-methylbutylamino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109286649 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | [5-(3-methylbutylamino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)CCNc1cnc(C(=O)N2CCN(c3ncccn3)CC2)cn1 |
| InChI | InChI=1S/C18H25N7O/c1-14(2)4-7-19-16-13-22-15(12-23-16)17(26)24-8-10-25(11-9-24)18-20-5-3-6-21-18/h3,5-6,12-14H,4,7-11H2,1-2H3,(H,19,23) |
| InChIKey | XSIQORCSIJLAKG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |