C18H25N7O — CID 109310655
[2-(3-methylbutylamino)pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 109310655) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is [2-(3-methylbutylamino)pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [2-(3-methylbutylamino)pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109310655 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | [2-(3-methylbutylamino)pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)CCNc1nccc(C(=O)N2CCN(c3ncccn3)CC2)n1 |
| InChI | InChI=1S/C18H25N7O/c1-14(2)4-8-19-17-20-9-5-15(23-17)16(26)24-10-12-25(13-11-24)18-21-6-3-7-22-18/h3,5-7,9,14H,4,8,10-13H2,1-2H3,(H,19,20,23) |
| InChIKey | SNQFVTWVRPWLBM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |