C19H26N8O2 — CID 109301449
[2-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 109301449) has the molecular formula C19H26N8O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is [2-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [2-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109301449 |
| Molecular Formula | C19H26N8O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | [2-(2-morpholin-4-ylethylamino)pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccnc(NCCN2CCOCC2)n1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H26N8O2/c28-17(26-8-10-27(11-9-26)19-22-3-1-4-23-19)16-2-5-20-18(24-16)21-6-7-25-12-14-29-15-13-25/h1-5H,6-15H2,(H,20,21,24) |
| InChIKey | VFSHRTSGBYSERA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |