C17H20FN5O2 — CID 109301487
N-(2-fluorophenyl)-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide (PubChem CID 109301487) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2-fluorophenyl)-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109301487 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(2-fluorophenyl)-2-(2-morpholin-4-ylethylamino)pyrimidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1F)c1ccnc(NCCN2CCOCC2)n1 |
| InChI | InChI=1S/C17H20FN5O2/c18-13-3-1-2-4-14(13)21-16(24)15-5-6-19-17(22-15)20-7-8-23-9-11-25-12-10-23/h1-6H,7-12H2,(H,21,24)(H,19,20,22) |
| InChIKey | ZUNLEGINCXUKRD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |