C19H25N5O3 — CID 109301562
2-[(2-methoxyphenyl)methylamino]-N-(2-morpholin-4-ylethyl)pyrimidine-4-carboxamide (PubChem CID 109301562) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methylamino]-N-(2-morpholin-4-ylethyl)pyrimidine-4-carboxamide.
| Compound Name | 2-[(2-methoxyphenyl)methylamino]-N-(2-morpholin-4-ylethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109301562 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-[(2-methoxyphenyl)methylamino]-N-(2-morpholin-4-ylethyl)pyrimidine-4-carboxamide |
| SMILES | COc1ccccc1CNc1nccc(C(=O)NCCN2CCOCC2)n1 |
| InChI | InChI=1S/C19H25N5O3/c1-26-17-5-3-2-4-15(17)14-22-19-21-7-6-16(23-19)18(25)20-8-9-24-10-12-27-13-11-24/h2-7H,8-14H2,1H3,(H,20,25)(H,21,22,23) |
| InChIKey | NIVQPBXHXIVOIT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |