C17H20N4O3 — CID 109300535
[2-[(2-methoxyphenyl)methylamino]pyrimidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 109300535) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methylamino]pyrimidin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-[(2-methoxyphenyl)methylamino]pyrimidin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 109300535 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | [2-[(2-methoxyphenyl)methylamino]pyrimidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | COc1ccccc1CNc1nccc(C(=O)N2CCOCC2)n1 |
| InChI | InChI=1S/C17H20N4O3/c1-23-15-5-3-2-4-13(15)12-19-17-18-7-6-14(20-17)16(22)21-8-10-24-11-9-21/h2-7H,8-12H2,1H3,(H,18,19,20) |
| InChIKey | XSOKRIDPTRTSDX-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |