C20H20FN7O — CID 109305270
[2-[(2-fluorophenyl)methylamino]pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 109305270) has the molecular formula C20H20FN7O and a molecular weight of 393.43 g/mol. Its IUPAC name is [2-[(2-fluorophenyl)methylamino]pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [2-[(2-fluorophenyl)methylamino]pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109305270 |
| Molecular Formula | C20H20FN7O |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [2-[(2-fluorophenyl)methylamino]pyrimidin-4-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccnc(NCc2ccccc2F)n1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H20FN7O/c21-16-5-2-1-4-15(16)14-25-19-22-9-6-17(26-19)18(29)27-10-12-28(13-11-27)20-23-7-3-8-24-20/h1-9H,10-14H2,(H,22,25,26) |
| InChIKey | PNMCLEOKUFULCK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |