C18H22FN5O2 — CID 112891105
ethyl 4-[4-[(2-fluorophenyl)methylamino]pyrimidin-2-yl]piperazine-1-carboxylate (PubChem CID 112891105) has the molecular formula C18H22FN5O2 and a molecular weight of 359.41 g/mol. Its IUPAC name is ethyl 4-[4-[(2-fluorophenyl)methylamino]pyrimidin-2-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-[(2-fluorophenyl)methylamino]pyrimidin-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112891105 |
| Molecular Formula | C18H22FN5O2 |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | ethyl 4-[4-[(2-fluorophenyl)methylamino]pyrimidin-2-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2nccc(NCc3ccccc3F)n2)CC1 |
| InChI | InChI=1S/C18H22FN5O2/c1-2-26-18(25)24-11-9-23(10-12-24)17-20-8-7-16(22-17)21-13-14-5-3-4-6-15(14)19/h3-8H,2,9-13H2,1H3,(H,20,21,22) |
| InChIKey | OQRDIAIDFVSMFX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |