C17H27N5O3 — CID 109310281
ethyl 4-[2-(3-methylbutylamino)pyrimidine-4-carbonyl]piperazine-1-carboxylate (PubChem CID 109310281) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is ethyl 4-[2-(3-methylbutylamino)pyrimidine-4-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-(3-methylbutylamino)pyrimidine-4-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109310281 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | ethyl 4-[2-(3-methylbutylamino)pyrimidine-4-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccnc(NCCC(C)C)n2)CC1 |
| InChI | InChI=1S/C17H27N5O3/c1-4-25-17(24)22-11-9-21(10-12-22)15(23)14-6-8-19-16(20-14)18-7-5-13(2)3/h6,8,13H,4-5,7,9-12H2,1-3H3,(H,18,19,20) |
| InChIKey | GHCMUEZZEFCVFR-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |