C16H21N7O — CID 109271423
[5-(propan-2-ylamino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 109271423) has the molecular formula C16H21N7O and a molecular weight of 327.39 g/mol. Its IUPAC name is [5-(propan-2-ylamino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [5-(propan-2-ylamino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109271423 |
| Molecular Formula | C16H21N7O |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | [5-(propan-2-ylamino)pyrazin-2-yl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)Nc1cnc(C(=O)N2CCN(c3ncccn3)CC2)cn1 |
| InChI | InChI=1S/C16H21N7O/c1-12(2)21-14-11-19-13(10-20-14)15(24)22-6-8-23(9-7-22)16-17-4-3-5-18-16/h3-5,10-12H,6-9H2,1-2H3,(H,20,21) |
| InChIKey | HMGUAYIVDPQOLU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |