C17H21N7O — CID 109273565
[5-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone (PubChem CID 109273565) has the molecular formula C17H21N7O and a molecular weight of 339.40 g/mol. Its IUPAC name is [5-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [5-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 109273565 |
| Molecular Formula | C17H21N7O |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [5-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazin-2-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cnc(N2CCN(c3ncccn3)CC2)cn1)N1CCCC1 |
| InChI | InChI=1S/C17H21N7O/c25-16(23-6-1-2-7-23)14-12-21-15(13-20-14)22-8-10-24(11-9-22)17-18-4-3-5-19-17/h3-5,12-13H,1-2,6-11H2 |
| InChIKey | YYVHKBGCOYCCRJ-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 78.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |