C18H22N6O2 — CID 109276621
(5-morpholin-4-ylpyrazin-2-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 109276621) has the molecular formula C18H22N6O2 and a molecular weight of 354.41 g/mol. Its IUPAC name is (5-morpholin-4-ylpyrazin-2-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (5-morpholin-4-ylpyrazin-2-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109276621 |
| Molecular Formula | C18H22N6O2 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (5-morpholin-4-ylpyrazin-2-yl)-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cnc(N2CCOCC2)cn1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H22N6O2/c25-18(15-13-21-17(14-20-15)23-9-11-26-12-10-23)24-7-5-22(6-8-24)16-3-1-2-4-19-16/h1-4,13-14H,5-12H2 |
| InChIKey | JZRYHPNBROPRJP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 74.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |