C20H26N6O — CID 109275060
(4-methylpiperidin-1-yl)-[5-(4-pyridin-2-ylpiperazin-1-yl)pyrazin-2-yl]methanone (PubChem CID 109275060) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-[5-(4-pyridin-2-ylpiperazin-1-yl)pyrazin-2-yl]methanone.
| Compound Name | (4-methylpiperidin-1-yl)-[5-(4-pyridin-2-ylpiperazin-1-yl)pyrazin-2-yl]methanone |
|---|---|
| PubChem CID | 109275060 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (4-methylpiperidin-1-yl)-[5-(4-pyridin-2-ylpiperazin-1-yl)pyrazin-2-yl]methanone |
| SMILES | CC1CCN(C(=O)c2cnc(N3CCN(c4ccccn4)CC3)cn2)CC1 |
| InChI | InChI=1S/C20H26N6O/c1-16-5-8-26(9-6-16)20(27)17-14-23-19(15-22-17)25-12-10-24(11-13-25)18-4-2-3-7-21-18/h2-4,7,14-16H,5-6,8-13H2,1H3 |
| InChIKey | YFFURDYMHMKNIU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 65.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |