C19H25N7O — CID 109274695
N-cyclohexyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazine-2-carboxamide (PubChem CID 109274695) has the molecular formula C19H25N7O and a molecular weight of 367.46 g/mol. Its IUPAC name is N-cyclohexyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazine-2-carboxamide.
| Compound Name | N-cyclohexyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109274695 |
| Molecular Formula | C19H25N7O |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | N-cyclohexyl-5-(4-pyrimidin-2-ylpiperazin-1-yl)pyrazine-2-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cnc(N2CCN(c3ncccn3)CC2)cn1 |
| InChI | InChI=1S/C19H25N7O/c27-18(24-15-5-2-1-3-6-15)16-13-23-17(14-22-16)25-9-11-26(12-10-25)19-20-7-4-8-21-19/h4,7-8,13-15H,1-3,5-6,9-12H2,(H,24,27) |
| InChIKey | WEIYJFLIDPMJRS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |