C21H19Cl2N5O — CID 134796457
[4-[4-(2-chloroanilino)pyrimidin-2-yl]piperazin-1-yl]-(3-chlorophenyl)methanone (PubChem CID 134796457) has the molecular formula C21H19Cl2N5O and a molecular weight of 428.32 g/mol. Its IUPAC name is [4-[4-(2-chloroanilino)pyrimidin-2-yl]piperazin-1-yl]-(3-chlorophenyl)methanone.
| Compound Name | [4-[4-(2-chloroanilino)pyrimidin-2-yl]piperazin-1-yl]-(3-chlorophenyl)methanone |
|---|---|
| PubChem CID | 134796457 |
| Molecular Formula | C21H19Cl2N5O |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | [4-[4-(2-chloroanilino)pyrimidin-2-yl]piperazin-1-yl]-(3-chlorophenyl)methanone |
| SMILES | O=C(c1cccc(Cl)c1)N1CCN(c2nccc(Nc3ccccc3Cl)n2)CC1 |
| InChI | InChI=1S/C21H19Cl2N5O/c22-16-5-3-4-15(14-16)20(29)27-10-12-28(13-11-27)21-24-9-8-19(26-21)25-18-7-2-1-6-17(18)23/h1-9,14H,10-13H2,(H,24,25,26) |
| InChIKey | XATQKRPOMAEAEE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |