C22H21Cl2N5O — CID 134800102
1-[4-[4-(2-chloroanilino)pyrimidin-2-yl]piperazin-1-yl]-2-(3-chlorophenyl)ethanone (PubChem CID 134800102) has the molecular formula C22H21Cl2N5O and a molecular weight of 442.35 g/mol. Its IUPAC name is 1-[4-[4-(2-chloroanilino)pyrimidin-2-yl]piperazin-1-yl]-2-(3-chlorophenyl)ethanone.
| Compound Name | 1-[4-[4-(2-chloroanilino)pyrimidin-2-yl]piperazin-1-yl]-2-(3-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 134800102 |
| Molecular Formula | C22H21Cl2N5O |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 1-[4-[4-(2-chloroanilino)pyrimidin-2-yl]piperazin-1-yl]-2-(3-chlorophenyl)ethanone |
| SMILES | O=C(Cc1cccc(Cl)c1)N1CCN(c2nccc(Nc3ccccc3Cl)n2)CC1 |
| InChI | InChI=1S/C22H21Cl2N5O/c23-17-5-3-4-16(14-17)15-21(30)28-10-12-29(13-11-28)22-25-9-8-20(27-22)26-19-7-2-1-6-18(19)24/h1-9,14H,10-13,15H2,(H,25,26,27) |
| InChIKey | ZEJBQODECIMEIT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |