C23H25N5O — CID 134796845
[4-[4-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]-(4-methylphenyl)methanone (PubChem CID 134796845) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is [4-[4-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]-(4-methylphenyl)methanone.
| Compound Name | [4-[4-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 134796845 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | [4-[4-(4-methylanilino)pyrimidin-2-yl]piperazin-1-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(Nc2ccnc(N3CCN(C(=O)c4ccc(C)cc4)CC3)n2)cc1 |
| InChI | InChI=1S/C23H25N5O/c1-17-3-7-19(8-4-17)22(29)27-13-15-28(16-14-27)23-24-12-11-21(26-23)25-20-9-5-18(2)6-10-20/h3-12H,13-16H2,1-2H3,(H,24,25,26) |
| InChIKey | UXSTZTPTRCEIHM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |