C25H35N5O — CID 134800003
N-(cycloheptylmethyl)-1-[4-(4-methylanilino)pyrimidin-2-yl]piperidine-4-carboxamide (PubChem CID 134800003) has the molecular formula C25H35N5O and a molecular weight of 421.59 g/mol. Its IUPAC name is N-(cycloheptylmethyl)-1-[4-(4-methylanilino)pyrimidin-2-yl]piperidine-4-carboxamide.
| Compound Name | N-(cycloheptylmethyl)-1-[4-(4-methylanilino)pyrimidin-2-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 134800003 |
| Molecular Formula | C25H35N5O |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.28 |
| IUPAC Name | N-(cycloheptylmethyl)-1-[4-(4-methylanilino)pyrimidin-2-yl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(Nc2ccnc(N3CCC(C(=O)NCC4CCCCCC4)CC3)n2)cc1 |
| InChI | InChI=1S/C25H35N5O/c1-19-8-10-22(11-9-19)28-23-12-15-26-25(29-23)30-16-13-21(14-17-30)24(31)27-18-20-6-4-2-3-5-7-20/h8-12,15,20-21H,2-7,13-14,16-18H2,1H3,(H,27,31)(H,26,28,29) |
| InChIKey | RQHLBADGYBNCJX-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |