C25H29N5O — CID 134802244
1-[4-(4-methylanilino)pyrimidin-2-yl]-N-(2-phenylethyl)piperidine-3-carboxamide (PubChem CID 134802244) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-[4-(4-methylanilino)pyrimidin-2-yl]-N-(2-phenylethyl)piperidine-3-carboxamide.
| Compound Name | 1-[4-(4-methylanilino)pyrimidin-2-yl]-N-(2-phenylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 134802244 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 1-[4-(4-methylanilino)pyrimidin-2-yl]-N-(2-phenylethyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(Nc2ccnc(N3CCCC(C(=O)NCCc4ccccc4)C3)n2)cc1 |
| InChI | InChI=1S/C25H29N5O/c1-19-9-11-22(12-10-19)28-23-14-16-27-25(29-23)30-17-5-8-21(18-30)24(31)26-15-13-20-6-3-2-4-7-20/h2-4,6-7,9-12,14,16,21H,5,8,13,15,17-18H2,1H3,(H,26,31)(H,27,28,29) |
| InChIKey | XNQPBCBAQZPMJB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |