C23H32N6O — CID 70770161
1-[1-(4-aminopyrimidin-2-yl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-3-carboxamide (PubChem CID 70770161) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 1-[1-(4-aminopyrimidin-2-yl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-3-carboxamide.
| Compound Name | 1-[1-(4-aminopyrimidin-2-yl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 70770161 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 1-[1-(4-aminopyrimidin-2-yl)piperidin-4-yl]-N-(2-phenylethyl)piperidine-3-carboxamide |
| SMILES | Nc1ccnc(N2CCC(N3CCCC(C(=O)NCCc4ccccc4)C3)CC2)n1 |
| InChI | InChI=1S/C23H32N6O/c24-21-9-13-26-23(27-21)28-15-10-20(11-16-28)29-14-4-7-19(17-29)22(30)25-12-8-18-5-2-1-3-6-18/h1-3,5-6,9,13,19-20H,4,7-8,10-12,14-17H2,(H,25,30)(H2,24,26,27) |
| InChIKey | RHOBSWREDQLQER-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |