C18H15ClF3N3O2 — CID 109080480
N-[4-chloro-2-(trifluoromethyl)phenyl]-4-(pyrrolidine-1-carbonyl)pyridine-2-carboxamide (PubChem CID 109080480) has the molecular formula C18H15ClF3N3O2 and a molecular weight of 397.78 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-4-(pyrrolidine-1-carbonyl)pyridine-2-carboxamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-4-(pyrrolidine-1-carbonyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109080480 |
| Molecular Formula | C18H15ClF3N3O2 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-4-(pyrrolidine-1-carbonyl)pyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(F)(F)F)c1cc(C(=O)N2CCCC2)ccn1 |
| InChI | InChI=1S/C18H15ClF3N3O2/c19-12-3-4-14(13(10-12)18(20,21)22)24-16(26)15-9-11(5-6-23-15)17(27)25-7-1-2-8-25/h3-6,9-10H,1-2,7-8H2,(H,24,26) |
| InChIKey | CKYTXQJLITUHKQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |