C16H14Cl2N2S2 — CID 3033254
N,N'-bis[(4-chlorophenyl)methyl]ethanedithioamide (PubChem CID 3033254) has the molecular formula C16H14Cl2N2S2 and a molecular weight of 369.34 g/mol. Its IUPAC name is N,N'-bis[(4-chlorophenyl)methyl]ethanedithioamide.
| Compound Name | N,N'-bis[(4-chlorophenyl)methyl]ethanedithioamide |
|---|---|
| PubChem CID | 3033254 |
| Molecular Formula | C16H14Cl2N2S2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | N,N'-bis[(4-chlorophenyl)methyl]ethanedithioamide |
| SMILES | S=C(NCc1ccc(Cl)cc1)C(=S)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14Cl2N2S2/c17-13-5-1-11(2-6-13)9-19-15(21)16(22)20-10-12-3-7-14(18)8-4-12/h1-8H,9-10H2,(H,19,21)(H,20,22) |
| InChIKey | AIUCBVRCPRHCDO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|