C15H14ClNOS — CID 11022677
4-chloro-N-[(4-methoxyphenyl)methyl]benzenecarbothioamide (PubChem CID 11022677) has the molecular formula C15H14ClNOS and a molecular weight of 291.80 g/mol. Its IUPAC name is 4-chloro-N-[(4-methoxyphenyl)methyl]benzenecarbothioamide.
| Compound Name | 4-chloro-N-[(4-methoxyphenyl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 11022677 |
| Molecular Formula | C15H14ClNOS |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 4-chloro-N-[(4-methoxyphenyl)methyl]benzenecarbothioamide |
| SMILES | COc1ccc(CNC(=S)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H14ClNOS/c1-18-14-8-2-11(3-9-14)10-17-15(19)12-4-6-13(16)7-5-12/h2-9H,10H2,1H3,(H,17,19) |
| InChIKey | ZJDLZEXSLIVNIT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|