C16H25FN2O — CID 108867688
1-[(4-fluorophenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)urea (PubChem CID 108867688) has the molecular formula C16H25FN2O and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)urea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)urea |
|---|---|
| PubChem CID | 108867688 |
| Molecular Formula | C16H25FN2O |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(2,4,4-trimethylpentan-2-yl)urea |
| SMILES | CC(C)(C)CC(C)(C)NC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H25FN2O/c1-15(2,3)11-16(4,5)19-14(20)18-10-12-6-8-13(17)9-7-12/h6-9H,10-11H2,1-5H3,(H2,18,19,20) |
| InChIKey | FQAWDJUULZJGTA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |