C14H20N2O3 — CID 64702591
3-methyl-3-[(4-methylphenyl)methylcarbamoylamino]butanoic acid (PubChem CID 64702591) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 3-methyl-3-[(4-methylphenyl)methylcarbamoylamino]butanoic acid.
| Compound Name | 3-methyl-3-[(4-methylphenyl)methylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 64702591 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-methyl-3-[(4-methylphenyl)methylcarbamoylamino]butanoic acid |
| SMILES | Cc1ccc(CNC(=O)NC(C)(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-10-4-6-11(7-5-10)9-15-13(19)16-14(2,3)8-12(17)18/h4-7H,8-9H2,1-3H3,(H,17,18)(H2,15,16,19) |
| InChIKey | XOJJINMCJLRXRM-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |