C14H30N4OS — CID 54572137
[N'-[4-(2-methylheptan-2-ylsulfanyl)butyl]carbamimidoyl]urea (PubChem CID 54572137) has the molecular formula C14H30N4OS and a molecular weight of 302.49 g/mol. Its IUPAC name is [N'-[4-(2-methylheptan-2-ylsulfanyl)butyl]carbamimidoyl]urea.
| Compound Name | [N'-[4-(2-methylheptan-2-ylsulfanyl)butyl]carbamimidoyl]urea |
|---|---|
| PubChem CID | 54572137 |
| Molecular Formula | C14H30N4OS |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | [N'-[4-(2-methylheptan-2-ylsulfanyl)butyl]carbamimidoyl]urea |
| SMILES | CCCCCC(C)(C)SCCCC/N=C(\N)NC(N)=O |
| InChI | InChI=1S/C14H30N4OS/c1-4-5-6-9-14(2,3)20-11-8-7-10-17-12(15)18-13(16)19/h4-11H2,1-3H3,(H5,15,16,17,18,19) |
| InChIKey | ZYAVSMJBXFRMPK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|