C12H28N10 — CID 176535600
1-[amino-[2-[amino-[(N'-heptylcarbamimidoyl)amino]methylidene]hydrazinyl]methylidene]-2-methylguanidine (PubChem CID 176535600) has the molecular formula C12H28N10 and a molecular weight of 312.43 g/mol. Its IUPAC name is 1-[amino-[2-[amino-[(N'-heptylcarbamimidoyl)amino]methylidene]hydrazinyl]methylidene]-2-methylguanidine.
| Compound Name | 1-[amino-[2-[amino-[(N'-heptylcarbamimidoyl)amino]methylidene]hydrazinyl]methylidene]-2-methylguanidine |
|---|---|
| PubChem CID | 176535600 |
| Molecular Formula | C12H28N10 |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 1-[amino-[2-[amino-[(N'-heptylcarbamimidoyl)amino]methylidene]hydrazinyl]methylidene]-2-methylguanidine |
| SMILES | CCCCCCC/N=C(\N)NC(N)=NNC(N)=N/C(N)=N/C |
| InChI | InChI=1S/C12H28N10/c1-3-4-5-6-7-8-18-10(14)20-12(16)22-21-11(15)19-9(13)17-2/h3-8H2,1-2H3,(H5,13,15,17,19,21)(H5,14,16,18,20,22) |
| InChIKey | RNERPSGJZDKYSA-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 177.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|