C19H44N6 — CID 155716609
heptan-1-amine;1-(N'-methylcarbamimidoyl)-2-(7-methyloctyl)guanidine (PubChem CID 155716609) has the molecular formula C19H44N6 and a molecular weight of 356.60 g/mol. Its IUPAC name is heptan-1-amine;1-(N'-methylcarbamimidoyl)-2-(7-methyloctyl)guanidine.
| Compound Name | heptan-1-amine;1-(N'-methylcarbamimidoyl)-2-(7-methyloctyl)guanidine |
|---|---|
| PubChem CID | 155716609 |
| Molecular Formula | C19H44N6 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.36 |
| IUPAC Name | heptan-1-amine;1-(N'-methylcarbamimidoyl)-2-(7-methyloctyl)guanidine |
| SMILES | C/N=C(\N)N/C(N)=N/CCCCCCC(C)C.CCCCCCCN |
| InChI | InChI=1S/C12H27N5.C7H17N/c1-10(2)8-6-4-5-7-9-16-12(14)17-11(13)15-3;1-2-3-4-5-6-7-8/h10H,4-9H2,1-3H3,(H5,13,14,15,16,17);2-8H2,1H3 |
| InChIKey | QQQFRNPYBJIODS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|