C28H58N8 — CID 59483424
2-[6-[[amino-[1-(2-ethylhexylamino)ethenylamino]methylidene]amino]hexyl]-1-[1-(2-ethylhexylamino)ethenyl]guanidine (PubChem CID 59483424) has the molecular formula C28H58N8 and a molecular weight of 506.83 g/mol. Its IUPAC name is 2-[6-[[amino-[1-(2-ethylhexylamino)ethenylamino]methylidene]amino]hexyl]-1-[1-(2-ethylhexylamino)ethenyl]guanidine.
| Compound Name | 2-[6-[[amino-[1-(2-ethylhexylamino)ethenylamino]methylidene]amino]hexyl]-1-[1-(2-ethylhexylamino)ethenyl]guanidine |
|---|---|
| PubChem CID | 59483424 |
| Molecular Formula | C28H58N8 |
| Molecular Weight | 506.83 g/mol |
| Exact Mass | 506.48 |
| IUPAC Name | 2-[6-[[amino-[1-(2-ethylhexylamino)ethenylamino]methylidene]amino]hexyl]-1-[1-(2-ethylhexylamino)ethenyl]guanidine |
| SMILES | C=C(NCC(CC)CCCC)N/C(N)=N/CCCCCC/N=C(\N)NC(=C)NCC(CC)CCCC |
| InChI | InChI=1S/C28H58N8/c1-7-11-17-25(9-3)21-33-23(5)35-27(29)31-19-15-13-14-16-20-32-28(30)36-24(6)34-22-26(10-4)18-12-8-2/h25-26,33-34H,5-22H2,1-4H3,(H3,29,31,35)(H3,30,32,36) |
| InChIKey | VFEVFTSOHOZSCW-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.83 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|