C8H19N5O — CID 83036993
1-(diaminomethylidene)-2-(2-ethyl-4-hydroxybutyl)guanidine (PubChem CID 83036993) has the molecular formula C8H19N5O and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(2-ethyl-4-hydroxybutyl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(2-ethyl-4-hydroxybutyl)guanidine |
|---|---|
| PubChem CID | 83036993 |
| Molecular Formula | C8H19N5O |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 1-(diaminomethylidene)-2-(2-ethyl-4-hydroxybutyl)guanidine |
| SMILES | CCC(CCO)C/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C8H19N5O/c1-2-6(3-4-14)5-12-8(11)13-7(9)10/h6,14H,2-5H2,1H3,(H6,9,10,11,12,13) |
| InChIKey | UDDMEUHRUCYPNH-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 123.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|