C27H51ClN8 — CID 162216152
N'-[N'-(4-chlorophenyl)carbamimidoyl]pentanimidamide;N'-[N'-(2-ethylhexyl)carbamimidoyl]pentanimidamide;methane (PubChem CID 162216152) has the molecular formula C27H51ClN8 and a molecular weight of 523.21 g/mol. Its IUPAC name is N'-[N'-(4-chlorophenyl)carbamimidoyl]pentanimidamide;N'-[N'-(2-ethylhexyl)carbamimidoyl]pentanimidamide;methane.
| Compound Name | N'-[N'-(4-chlorophenyl)carbamimidoyl]pentanimidamide;N'-[N'-(2-ethylhexyl)carbamimidoyl]pentanimidamide;methane |
|---|---|
| PubChem CID | 162216152 |
| Molecular Formula | C27H51ClN8 |
| Molecular Weight | 523.21 g/mol |
| Exact Mass | 522.39 |
| IUPAC Name | N'-[N'-(4-chlorophenyl)carbamimidoyl]pentanimidamide;N'-[N'-(2-ethylhexyl)carbamimidoyl]pentanimidamide;methane |
| SMILES | C.CCCCC(N)=N/C(N)=N/CC(CC)CCCC.CCCCC(N)=N/C(N)=N/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H30N4.C12H17ClN4.CH4/c1-4-7-9-12(6-3)11-17-14(16)18-13(15)10-8-5-2;1-2-3-4-11(14)17-12(15)16-10-7-5-9(13)6-8-10;/h12H,4-11H2,1-3H3,(H4,15,16,17,18);5-8H,2-4H2,1H3,(H4,14,15,16,17);1H4 |
| InChIKey | ZTMLCXGTQRVZOM-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 153.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.21 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|