C28H35ClN4 — CID 143072514
N'-(4-chlorophenyl)-6-(4-heptan-3-ylpiperazin-1-yl)naphthalene-2-carboximidamide (PubChem CID 143072514) has the molecular formula C28H35ClN4 and a molecular weight of 463.07 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-6-(4-heptan-3-ylpiperazin-1-yl)naphthalene-2-carboximidamide.
| Compound Name | N'-(4-chlorophenyl)-6-(4-heptan-3-ylpiperazin-1-yl)naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 143072514 |
| Molecular Formula | C28H35ClN4 |
| Molecular Weight | 463.07 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | N'-(4-chlorophenyl)-6-(4-heptan-3-ylpiperazin-1-yl)naphthalene-2-carboximidamide |
| SMILES | CCCCC(CC)N1CCN(c2ccc3cc(/C(N)=N/c4ccc(Cl)cc4)ccc3c2)CC1 |
| InChI | InChI=1S/C28H35ClN4/c1-3-5-6-26(4-2)32-15-17-33(18-16-32)27-14-9-21-19-23(8-7-22(21)20-27)28(30)31-25-12-10-24(29)11-13-25/h7-14,19-20,26H,3-6,15-18H2,1-2H3,(H2,30,31) |
| InChIKey | UJXZNCPVZOVHCY-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.07 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|